C34H33ClN2O5S — CID 167417682
4-[2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-1-oxo-3H-isoindol-5-yl]but-3-yn-2-yl 4-methylbenzenesulfonate (PubChem CID 167417682) has the molecular formula C34H33ClN2O5S and a molecular weight of 617.17 g/mol. Its IUPAC name is 4-[2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-1-oxo-3H-isoindol-5-yl]but-3-yn-2-yl 4-methylbenzenesulfonate.
| Compound Name | 4-[2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-1-oxo-3H-isoindol-5-yl]but-3-yn-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167417682 |
| Molecular Formula | C34H33ClN2O5S |
| Molecular Weight | 617.17 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 4-[2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-1-oxo-3H-isoindol-5-yl]but-3-yn-2-yl 4-methylbenzenesulfonate |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(N3Cc4cc(C#CC(C)OS(=O)(=O)c5ccc(C)cc5)ccc4C3=O)C2(C)C)cc1Cl |
| InChI | InChI=1S/C34H33ClN2O5S/c1-21-8-14-26(15-9-21)43(39,40)42-22(2)10-11-23-12-16-27-24(18-23)20-37(30(27)38)31-33(3,4)32(34(31,5)6)41-25-13-17-29(36-7)28(35)19-25/h8-9,12-19,22,31-32H,20H2,1-6H3 |
| InChIKey | OYXQMCPZCOAZEB-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 77.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.17 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|