C26H32N2O3 — CID 170683288
N-[3-(4-isocyano-3-methoxyphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-propan-2-ylbenzamide (PubChem CID 170683288) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-[3-(4-isocyano-3-methoxyphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[3-(4-isocyano-3-methoxyphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 170683288 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-[3-(4-isocyano-3-methoxyphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-propan-2-ylbenzamide |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)c3ccc(C(C)C)cc3)C2(C)C)cc1OC |
| InChI | InChI=1S/C26H32N2O3/c1-16(2)17-9-11-18(12-10-17)22(29)28-23-25(3,4)24(26(23,5)6)31-19-13-14-20(27-7)21(15-19)30-8/h9-16,23-24H,1-6,8H3,(H,28,29) |
| InChIKey | QBHPQFQXUZWKON-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 51.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|