C31H37ClN4O2 — CID 170666610
N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-(4-pent-4-ynylpiperazin-1-yl)benzamide (PubChem CID 170666610) has the molecular formula C31H37ClN4O2 and a molecular weight of 533.12 g/mol. Its IUPAC name is N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-(4-pent-4-ynylpiperazin-1-yl)benzamide.
| Compound Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-(4-pent-4-ynylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 170666610 |
| Molecular Formula | C31H37ClN4O2 |
| Molecular Weight | 533.12 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-(4-pent-4-ynylpiperazin-1-yl)benzamide |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)c3ccc(N4CCN(CCCC#C)CC4)cc3)C2(C)C)cc1Cl |
| InChI | InChI=1S/C31H37ClN4O2/c1-7-8-9-16-35-17-19-36(20-18-35)23-12-10-22(11-13-23)27(37)34-28-30(2,3)29(31(28,4)5)38-24-14-15-26(33-6)25(32)21-24/h1,10-15,21,28-29H,8-9,16-20H2,2-5H3,(H,34,37) |
| InChIKey | QNCDJKGHDJJZDJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 49.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.12 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|