C29H34ClN5O3 — CID 140860999
N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-(5-hydroxypentyl)triazol-1-yl]benzamide (PubChem CID 140860999) has the molecular formula C29H34ClN5O3 and a molecular weight of 536.08 g/mol. Its IUPAC name is N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-(5-hydroxypentyl)triazol-1-yl]benzamide.
| Compound Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-(5-hydroxypentyl)triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 140860999 |
| Molecular Formula | C29H34ClN5O3 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-(5-hydroxypentyl)triazol-1-yl]benzamide |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)c3ccc(-n4cc(CCCCCO)nn4)cc3)C2(C)C)cc1Cl |
| InChI | InChI=1S/C29H34ClN5O3/c1-28(2)26(29(3,4)27(28)38-22-14-15-24(31-5)23(30)17-22)32-25(37)19-10-12-21(13-11-19)35-18-20(33-34-35)9-7-6-8-16-36/h10-15,17-18,26-27,36H,6-9,16H2,1-4H3,(H,32,37) |
| InChIKey | GPHJDKMPCGDKCH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|