C40H55F3N4O4 — CID 153467052
tert-butyl (3S,5R)-4-[6-[4-[[3-[4-isocyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]carbamoyl]phenyl]hexyl]-3,5-dimethylpiperazine-1-carboxylate (PubChem CID 153467052) has the molecular formula C40H55F3N4O4 and a molecular weight of 712.90 g/mol. Its IUPAC name is tert-butyl (3S,5R)-4-[6-[4-[[3-[4-isocyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]carbamoyl]phenyl]hexyl]-3,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-4-[6-[4-[[3-[4-isocyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]carbamoyl]phenyl]hexyl]-3,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 153467052 |
| Molecular Formula | C40H55F3N4O4 |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.42 |
| IUPAC Name | tert-butyl (3S,5R)-4-[6-[4-[[3-[4-isocyano-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]carbamoyl]phenyl]hexyl]-3,5-dimethylpiperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)c3ccc(CCCCCCN4[C@H](C)CN(C(=O)OC(C)(C)C)C[C@@H]4C)cc3)C2(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C40H55F3N4O4/c1-26-24-46(36(49)51-37(3,4)5)25-27(2)47(26)22-14-12-11-13-15-28-16-18-29(19-17-28)33(48)45-34-38(6,7)35(39(34,8)9)50-30-20-21-32(44-10)31(23-30)40(41,42)43/h16-21,23,26-27,34-35H,11-15,22,24-25H2,1-9H3,(H,45,48)/t26-,27+,34?,35? |
| InChIKey | UMNNXLPYUMTQRO-GHFJEWJFSA-N |
| XLogP | 9.30 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|