C28H32ClN5O3 — CID 153467079
N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-(3-methoxypropyl)triazol-1-yl]benzamide (PubChem CID 153467079) has the molecular formula C28H32ClN5O3 and a molecular weight of 522.05 g/mol. Its IUPAC name is N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-(3-methoxypropyl)triazol-1-yl]benzamide.
| Compound Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-(3-methoxypropyl)triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 153467079 |
| Molecular Formula | C28H32ClN5O3 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[4-(3-methoxypropyl)triazol-1-yl]benzamide |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)c3ccc(-n4cc(CCCOC)nn4)cc3)C2(C)C)cc1Cl |
| InChI | InChI=1S/C28H32ClN5O3/c1-27(2)25(28(3,4)26(27)37-21-13-14-23(30-5)22(29)16-21)31-24(35)18-9-11-20(12-10-18)34-17-19(32-33-34)8-7-15-36-6/h9-14,16-17,25-26H,7-8,15H2,1-4,6H3,(H,31,35) |
| InChIKey | YSGCBHBAXUCLAM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|