C22H24ClN3O2 — CID 170513934
N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-6-methylpyridine-3-carboxamide (PubChem CID 170513934) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 170513934 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-6-methylpyridine-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)c3ccc(C)nc3)C2(C)C)cc1Cl |
| InChI | InChI=1S/C22H24ClN3O2/c1-13-7-8-14(12-25-13)18(27)26-19-21(2,3)20(22(19,4)5)28-15-9-10-17(24-6)16(23)11-15/h7-12,19-20H,1-5H3,(H,26,27) |
| InChIKey | RBHHIRDBVBNAGX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|