C23H24ClFN2O2 — CID 170513653
N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-3-fluoro-4-methylbenzamide (PubChem CID 170513653) has the molecular formula C23H24ClFN2O2 and a molecular weight of 414.91 g/mol. Its IUPAC name is N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 170513653 |
| Molecular Formula | C23H24ClFN2O2 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-3-fluoro-4-methylbenzamide |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)c3ccc(C)c(F)c3)C2(C)C)cc1Cl |
| InChI | InChI=1S/C23H24ClFN2O2/c1-13-7-8-14(11-17(13)25)19(28)27-20-22(2,3)21(23(20,4)5)29-15-9-10-18(26-6)16(24)12-15/h7-12,20-21H,1-5H3,(H,27,28) |
| InChIKey | FZYYRCAYAPOHAN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|