C27H34N2O2 — CID 170683297
N-[3-(4-isocyano-3,5-dimethylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-propan-2-ylbenzamide (PubChem CID 170683297) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-[3-(4-isocyano-3,5-dimethylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[3-(4-isocyano-3,5-dimethylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 170683297 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-[3-(4-isocyano-3,5-dimethylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-propan-2-ylbenzamide |
| SMILES | [C-]#[N+]c1c(C)cc(OC2C(C)(C)C(NC(=O)c3ccc(C(C)C)cc3)C2(C)C)cc1C |
| InChI | InChI=1S/C27H34N2O2/c1-16(2)19-10-12-20(13-11-19)23(30)29-24-26(5,6)25(27(24,7)8)31-21-14-17(3)22(28-9)18(4)15-21/h10-16,24-25H,1-8H3,(H,29,30) |
| InChIKey | UFIVIWVYZQVYQM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|