C15H21ClN2O — CID 79710945
N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-4-chlorobenzamide (PubChem CID 79710945) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-4-chlorobenzamide.
| Compound Name | N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 79710945 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-4-chlorobenzamide |
| SMILES | CC1(C)C(N)C(C)(C)C1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClN2O/c1-14(2)12(17)15(3,4)13(14)18-11(19)9-5-7-10(16)8-6-9/h5-8,12-13H,17H2,1-4H3,(H,18,19) |
| InChIKey | WHXSRNZNMNQSCB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |