C15H22N2O3 — CID 107728779
N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-3,4-dihydroxybenzamide (PubChem CID 107728779) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-3,4-dihydroxybenzamide.
| Compound Name | N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 107728779 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-3,4-dihydroxybenzamide |
| SMILES | CC1(C)C(N)C(C)(C)C1NC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-14(2)12(16)15(3,4)13(14)17-11(20)8-5-6-9(18)10(19)7-8/h5-7,12-13,18-19H,16H2,1-4H3,(H,17,20) |
| InChIKey | NIBIQSLNRDGVLD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|