About N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide
N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide (PubChem CID 107727566) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide |
| PubChem CID | 107727566 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide |
| SMILES | CC1(C)C(N)CC1NC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-13(2)10(14)6-11(13)15-12(18)7-3-4-8(16)9(17)5-7/h3-5,10-11,16-17H,6,14H2,1-2H3,(H,15,18) |
| InChIKey | SPPOBHSLPPTIRI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide?
The IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide (CID 107727566) is N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide?
The canonical SMILES for N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide is CC1(C)C(N)CC1NC(=O)c1ccc(O)c(O)c1.
What is the InChIKey of N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide?
The InChIKey is SPPOBHSLPPTIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3/c1-13(2)10(14)6-11(13)15-12(18)7-3-4-8(16)9(17)5-7/h3-5,10-11,16-17H,6,14H2,1-2H3,(H,15,18).
What are the key properties of N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide?
N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide has a molecular weight of 250.30 g/mol, XLogP of 0.95, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dihydroxybenzamide is sourced from PubChem (CID 107727566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).