About N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide
N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide (PubChem CID 114632315) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide |
| PubChem CID | 114632315 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CC(N)C2(C)C)cc1OC |
| InChI | InChI=1S/C15H22N2O3/c1-15(2)12(16)8-13(15)17-14(18)9-5-6-10(19-3)11(7-9)20-4/h5-7,12-13H,8,16H2,1-4H3,(H,17,18) |
| InChIKey | WFBCJQNQJQCORJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide?
The IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide (CID 114632315) is N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide?
The canonical SMILES for N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide is COc1ccc(C(=O)NC2CC(N)C2(C)C)cc1OC.
What is the InChIKey of N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide?
The InChIKey is WFBCJQNQJQCORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-15(2)12(16)8-13(15)17-14(18)9-5-6-10(19-3)11(7-9)20-4/h5-7,12-13H,8,16H2,1-4H3,(H,17,18).
What are the key properties of N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide?
N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide has a molecular weight of 278.35 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylcyclobutyl)-3,4-dimethoxybenzamide is sourced from PubChem (CID 114632315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).