C15H18N4O — CID 114632331
N-(3-amino-2,2-dimethylcyclobutyl)quinoxaline-6-carboxamide (PubChem CID 114632331) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylcyclobutyl)quinoxaline-6-carboxamide.
| Compound Name | N-(3-amino-2,2-dimethylcyclobutyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 114632331 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-(3-amino-2,2-dimethylcyclobutyl)quinoxaline-6-carboxamide |
| SMILES | CC1(C)C(N)CC1NC(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C15H18N4O/c1-15(2)12(16)8-13(15)19-14(20)9-3-4-10-11(7-9)18-6-5-17-10/h3-7,12-13H,8,16H2,1-2H3,(H,19,20) |
| InChIKey | MVXGVOVFMNEJOG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |