C17H26N2O — CID 79711984
N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-4-ethylbenzamide (PubChem CID 79711984) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-4-ethylbenzamide.
| Compound Name | N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-4-ethylbenzamide |
|---|---|
| PubChem CID | 79711984 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC2C(C)(C)C(N)C2(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O/c1-6-11-7-9-12(10-8-11)13(20)19-15-16(2,3)14(18)17(15,4)5/h7-10,14-15H,6,18H2,1-5H3,(H,19,20) |
| InChIKey | CBXVWPJLBOOVMI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |