C34H41BrN2O5 — CID 167417477
tert-butyl 2-[6-[4-[[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamoyl]phenyl]hex-5-ynoxy]acetate (PubChem CID 167417477) has the molecular formula C34H41BrN2O5 and a molecular weight of 637.61 g/mol. Its IUPAC name is tert-butyl 2-[6-[4-[[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamoyl]phenyl]hex-5-ynoxy]acetate.
| Compound Name | tert-butyl 2-[6-[4-[[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamoyl]phenyl]hex-5-ynoxy]acetate |
|---|---|
| PubChem CID | 167417477 |
| Molecular Formula | C34H41BrN2O5 |
| Molecular Weight | 637.61 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | tert-butyl 2-[6-[4-[[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamoyl]phenyl]hex-5-ynoxy]acetate |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)c3ccc(C#CCCCCOCC(=O)OC(C)(C)C)cc3)C2(C)C)cc1Br |
| InChI | InChI=1S/C34H41BrN2O5/c1-32(2,3)42-28(38)22-40-20-12-10-9-11-13-23-14-16-24(17-15-23)29(39)37-30-33(4,5)31(34(30,6)7)41-25-18-19-27(36-8)26(35)21-25/h14-19,21,30-31H,9-10,12,20,22H2,1-7H3,(H,37,39) |
| InChIKey | PAKRWOYPRTVESJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|