C17H18BrF3N2O2 — CID 167417809
N-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-2,2,2-trifluoroacetamide (PubChem CID 167417809) has the molecular formula C17H18BrF3N2O2 and a molecular weight of 419.24 g/mol. Its IUPAC name is N-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167417809 |
| Molecular Formula | C17H18BrF3N2O2 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | N-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-2,2,2-trifluoroacetamide |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(NC(=O)C(F)(F)F)C2(C)C)cc1Br |
| InChI | InChI=1S/C17H18BrF3N2O2/c1-15(2)12(23-14(24)17(19,20)21)16(3,4)13(15)25-9-6-7-11(22-5)10(18)8-9/h6-8,12-13H,1-4H3,(H,23,24) |
| InChIKey | RMKAMHAQTVJVFS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|