C23H26BrN3O3 — CID 167417892
N-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(2-hydroxyethyl)pyridine-3-carboxamide (PubChem CID 167417892) has the molecular formula C23H26BrN3O3 and a molecular weight of 472.38 g/mol. Its IUPAC name is N-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(2-hydroxyethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(2-hydroxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167417892 |
| Molecular Formula | C23H26BrN3O3 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(2-hydroxyethyl)pyridine-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(N(CCO)C(=O)c3cccnc3)C2(C)C)cc1Br |
| InChI | InChI=1S/C23H26BrN3O3/c1-22(2)20(27(11-12-28)19(29)15-7-6-10-26-14-15)23(3,4)21(22)30-16-8-9-18(25-5)17(24)13-16/h6-10,13-14,20-21,28H,11-12H2,1-4H3 |
| InChIKey | FFNUIEDBGXGHPG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|