C23H31N3O3 — CID 24732014
N-(2-methoxyethyl)-N-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 24732014) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24732014 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-(2-methoxyethyl)-N-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | COCCN(C(=O)c1cccnc1)C1CCN(CCc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H31N3O3/c1-28-17-16-26(23(27)20-4-3-12-24-18-20)21-10-14-25(15-11-21)13-9-19-5-7-22(29-2)8-6-19/h3-8,12,18,21H,9-11,13-17H2,1-2H3 |
| InChIKey | PNDMCYGUSARYNW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |