C27H30ClN3O — CID 24731148
N-[1-[2-(4-chlorophenyl)ethyl]piperidin-4-yl]-N-(2-phenylethyl)pyridine-3-carboxamide (PubChem CID 24731148) has the molecular formula C27H30ClN3O and a molecular weight of 448.01 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)ethyl]piperidin-4-yl]-N-(2-phenylethyl)pyridine-3-carboxamide.
| Compound Name | N-[1-[2-(4-chlorophenyl)ethyl]piperidin-4-yl]-N-(2-phenylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24731148 |
| Molecular Formula | C27H30ClN3O |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)ethyl]piperidin-4-yl]-N-(2-phenylethyl)pyridine-3-carboxamide |
| SMILES | O=C(c1cccnc1)N(CCc1ccccc1)C1CCN(CCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H30ClN3O/c28-25-10-8-23(9-11-25)12-17-30-18-14-26(15-19-30)31(20-13-22-5-2-1-3-6-22)27(32)24-7-4-16-29-21-24/h1-11,16,21,26H,12-15,17-20H2 |
| InChIKey | GHAXRBGPZJHUAH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |