C9H13N3O2 — CID 91621752
N'-(2-hydroxyethyl)-N'-methylpyridine-3-carbohydrazide (PubChem CID 91621752) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is N'-(2-hydroxyethyl)-N'-methylpyridine-3-carbohydrazide.
| Compound Name | N'-(2-hydroxyethyl)-N'-methylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 91621752 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N'-(2-hydroxyethyl)-N'-methylpyridine-3-carbohydrazide |
| SMILES | CN(CCO)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C9H13N3O2/c1-12(5-6-13)11-9(14)8-3-2-4-10-7-8/h2-4,7,13H,5-6H2,1H3,(H,11,14) |
| InChIKey | LIBASYKVMGDWIN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|