About N'-benzyl-N'-phenylpyridine-3-carbohydrazide
N'-benzyl-N'-phenylpyridine-3-carbohydrazide (PubChem CID 51156325) has the molecular formula C19H17N3O
and a molecular weight of 303.37 g/mol. Its IUPAC name is N'-benzyl-N'-phenylpyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | N'-benzyl-N'-phenylpyridine-3-carbohydrazide |
| PubChem CID | 51156325 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N'-benzyl-N'-phenylpyridine-3-carbohydrazide |
| SMILES | O=C(NN(Cc1ccccc1)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C19H17N3O/c23-19(17-10-7-13-20-14-17)21-22(18-11-5-2-6-12-18)15-16-8-3-1-4-9-16/h1-14H,15H2,(H,21,23) |
| InChIKey | LGQSGQWLLBQRGA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N'-phenylpyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-phenylpyridine-3-carbohydrazide?
The IUPAC name of N'-benzyl-N'-phenylpyridine-3-carbohydrazide (CID 51156325) is N'-benzyl-N'-phenylpyridine-3-carbohydrazide.
What is the SMILES notation for N'-benzyl-N'-phenylpyridine-3-carbohydrazide?
The canonical SMILES for N'-benzyl-N'-phenylpyridine-3-carbohydrazide is O=C(NN(Cc1ccccc1)c1ccccc1)c1cccnc1.
What is the InChIKey of N'-benzyl-N'-phenylpyridine-3-carbohydrazide?
The InChIKey is LGQSGQWLLBQRGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O/c23-19(17-10-7-13-20-14-17)21-22(18-11-5-2-6-12-18)15-16-8-3-1-4-9-16/h1-14H,15H2,(H,21,23).
What are the key properties of N'-benzyl-N'-phenylpyridine-3-carbohydrazide?
N'-benzyl-N'-phenylpyridine-3-carbohydrazide has a molecular weight of 303.37 g/mol, XLogP of 3.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-phenylpyridine-3-carbohydrazide is sourced from PubChem (CID 51156325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).