C15H13F3N2O — CID 71671643
N'-benzyl-2,2,2-trifluoro-N'-phenylacetohydrazide (PubChem CID 71671643) has the molecular formula C15H13F3N2O and a molecular weight of 294.28 g/mol. Its IUPAC name is N'-benzyl-2,2,2-trifluoro-N'-phenylacetohydrazide.
| Compound Name | N'-benzyl-2,2,2-trifluoro-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 71671643 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N'-benzyl-2,2,2-trifluoro-N'-phenylacetohydrazide |
| SMILES | O=C(NN(Cc1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O/c16-15(17,18)14(21)19-20(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2,(H,19,21) |
| InChIKey | WYQYNZJGZIFWMG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|