About N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide
N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide (PubChem CID 55342142) has the molecular formula C21H17F3N2O
and a molecular weight of 370.37 g/mol. Its IUPAC name is N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide.
Molecular Properties
| Compound Name | N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide |
| PubChem CID | 55342142 |
| Molecular Formula | C21H17F3N2O |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NN(Cc1ccccc1)c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H17F3N2O/c22-21(23,24)19-14-8-7-13-18(19)20(27)25-26(17-11-5-2-6-12-17)15-16-9-3-1-4-10-16/h1-14H,15H2,(H,25,27) |
| InChIKey | HCWAEAFDUQODHW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide?
The IUPAC name of N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide (CID 55342142) is N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide.
What is the SMILES notation for N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide?
The canonical SMILES for N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide is O=C(NN(Cc1ccccc1)c1ccccc1)c1ccccc1C(F)(F)F.
What is the InChIKey of N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide?
The InChIKey is HCWAEAFDUQODHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F3N2O/c22-21(23,24)19-14-8-7-13-18(19)20(27)25-26(17-11-5-2-6-12-17)15-16-9-3-1-4-10-16/h1-14H,15H2,(H,25,27).
What are the key properties of N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide?
N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide has a molecular weight of 370.37 g/mol, XLogP of 5.06, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-phenyl-2-(trifluoromethyl)benzohydrazide is sourced from PubChem (CID 55342142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).