C20H15F3N2O — CID 51537446
N',N'-diphenyl-2-(trifluoromethyl)benzohydrazide (PubChem CID 51537446) has the molecular formula C20H15F3N2O and a molecular weight of 356.35 g/mol. Its IUPAC name is N',N'-diphenyl-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N',N'-diphenyl-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 51537446 |
| Molecular Formula | C20H15F3N2O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N',N'-diphenyl-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H15F3N2O/c21-20(22,23)18-14-8-7-13-17(18)19(26)24-25(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,(H,24,26) |
| InChIKey | AFTWJKFMXULUDT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|