About N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide
N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide (PubChem CID 75479031) has the molecular formula C20H17ClN2O2
and a molecular weight of 352.82 g/mol. Its IUPAC name is N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide |
| PubChem CID | 75479031 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide |
| SMILES | O=C(NN(Cc1ccccc1)c1ccccc1)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C20H17ClN2O2/c21-18-13-16(11-12-19(18)24)20(25)22-23(17-9-5-2-6-10-17)14-15-7-3-1-4-8-15/h1-13,24H,14H2,(H,22,25) |
| InChIKey | JSSZFMOUZQLVLL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide?
The IUPAC name of N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide (CID 75479031) is N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide.
What is the SMILES notation for N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide?
The canonical SMILES for N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide is O=C(NN(Cc1ccccc1)c1ccccc1)c1ccc(O)c(Cl)c1.
What is the InChIKey of N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide?
The InChIKey is JSSZFMOUZQLVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN2O2/c21-18-13-16(11-12-19(18)24)20(25)22-23(17-9-5-2-6-10-17)14-15-7-3-1-4-8-15/h1-13,24H,14H2,(H,22,25).
What are the key properties of N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide?
N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide has a molecular weight of 352.82 g/mol, XLogP of 4.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-3-chloro-4-hydroxy-N'-phenylbenzohydrazide is sourced from PubChem (CID 75479031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).