C24H25N3O2S — CID 9206617
2-[2-[(N-benzylanilino)carbamoyl]phenyl]sulfanyl-N,N-dimethylacetamide (PubChem CID 9206617) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-[2-[(N-benzylanilino)carbamoyl]phenyl]sulfanyl-N,N-dimethylacetamide.
| Compound Name | 2-[2-[(N-benzylanilino)carbamoyl]phenyl]sulfanyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 9206617 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[2-[(N-benzylanilino)carbamoyl]phenyl]sulfanyl-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CSc1ccccc1C(=O)NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O2S/c1-26(2)23(28)18-30-22-16-10-9-15-21(22)24(29)25-27(20-13-7-4-8-14-20)17-19-11-5-3-6-12-19/h3-16H,17-18H2,1-2H3,(H,25,29) |
| InChIKey | FDOXXVJIWZWLPO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|