C19H24N2O3 — CID 122213269
tert-butyl N-(N-benzyl-4-methoxyanilino)carbamate (PubChem CID 122213269) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl N-(N-benzyl-4-methoxyanilino)carbamate.
| Compound Name | tert-butyl N-(N-benzyl-4-methoxyanilino)carbamate |
|---|---|
| PubChem CID | 122213269 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl N-(N-benzyl-4-methoxyanilino)carbamate |
| SMILES | COc1ccc(N(Cc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-19(2,3)24-18(22)20-21(14-15-8-6-5-7-9-15)16-10-12-17(23-4)13-11-16/h5-13H,14H2,1-4H3,(H,20,22) |
| InChIKey | SRHYOIJYAMIRHS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|