C34H41ClN2O5 — CID 167417343
tert-butyl 2-[5-[2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-3,3-dideuterio-1-oxo-3a,7a-dihydroisoindol-5-yl]pent-4-ynoxy]acetate (PubChem CID 167417343) has the molecular formula C34H41ClN2O5 and a molecular weight of 595.18 g/mol. Its IUPAC name is tert-butyl 2-[5-[2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-3,3-dideuterio-1-oxo-3a,7a-dihydroisoindol-5-yl]pent-4-ynoxy]acetate.
| Compound Name | tert-butyl 2-[5-[2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-3,3-dideuterio-1-oxo-3a,7a-dihydroisoindol-5-yl]pent-4-ynoxy]acetate |
|---|---|
| PubChem CID | 167417343 |
| Molecular Formula | C34H41ClN2O5 |
| Molecular Weight | 595.18 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | tert-butyl 2-[5-[2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-3,3-dideuterio-1-oxo-3a,7a-dihydroisoindol-5-yl]pent-4-ynoxy]acetate |
| SMILES | [2H]C1([2H])C2C=C(C#CCCCOCC(=O)OC(C)(C)C)C=CC2C(=O)N1C1C(C)(C)C(Oc2ccc([N+]#[C-])c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C34H41ClN2O5/c1-32(2,3)42-28(38)21-40-17-11-9-10-12-22-13-15-25-23(18-22)20-37(29(25)39)30-33(4,5)31(34(30,6)7)41-24-14-16-27(36-8)26(35)19-24/h13-16,18-19,23,25,30-31H,9,11,17,20-21H2,1-7H3/i20D2 |
| InChIKey | NXIJJMUONTVECH-FCLBBQIASA-N |
| XLogP | 6.79 |
| TPSA | 69.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.18 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|