C37H46ClN5O4 — CID 167417877
tert-butyl 4-[3-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-oxo-7,7a-dihydro-4aH-pyrrolo[3,4-b]pyridin-2-yl]ethynyl]cyclobutyl]piperazine-1-carboxylate (PubChem CID 167417877) has the molecular formula C37H46ClN5O4 and a molecular weight of 660.26 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-oxo-7,7a-dihydro-4aH-pyrrolo[3,4-b]pyridin-2-yl]ethynyl]cyclobutyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-oxo-7,7a-dihydro-4aH-pyrrolo[3,4-b]pyridin-2-yl]ethynyl]cyclobutyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167417877 |
| Molecular Formula | C37H46ClN5O4 |
| Molecular Weight | 660.26 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | tert-butyl 4-[3-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-oxo-7,7a-dihydro-4aH-pyrrolo[3,4-b]pyridin-2-yl]ethynyl]cyclobutyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CC(C#CC3=NC4CN(C5C(C)(C)C(Oc6ccc(C#N)c(Cl)c6)C5(C)C)C(=O)C4C=C3)C2)CC1 |
| InChI | InChI=1S/C37H46ClN5O4/c1-35(2,3)47-34(45)42-16-14-41(15-17-42)26-18-23(19-26)8-10-25-11-13-28-30(40-25)22-43(31(28)44)32-36(4,5)33(37(32,6)7)46-27-12-9-24(21-39)29(38)20-27/h9,11-13,20,23,26,28,30,32-33H,14-19,22H2,1-7H3 |
| InChIKey | GLSUPIDJSNIBKL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 98.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.26 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|