C42H52ClN5O4 — CID 155219285
tert-butyl 7-[4-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-2-yl]ethynyl]cyclohexyl]-2,7-diazaspiro[3.5]nonane-2-carboxylate (PubChem CID 155219285) has the molecular formula C42H52ClN5O4 and a molecular weight of 726.36 g/mol. Its IUPAC name is tert-butyl 7-[4-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-2-yl]ethynyl]cyclohexyl]-2,7-diazaspiro[3.5]nonane-2-carboxylate.
| Compound Name | tert-butyl 7-[4-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-2-yl]ethynyl]cyclohexyl]-2,7-diazaspiro[3.5]nonane-2-carboxylate |
|---|---|
| PubChem CID | 155219285 |
| Molecular Formula | C42H52ClN5O4 |
| Molecular Weight | 726.36 g/mol |
| Exact Mass | 725.37 |
| IUPAC Name | tert-butyl 7-[4-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-2-yl]ethynyl]cyclohexyl]-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCN(C3CCC(C#Cc4ccc5c(n4)CN(C4C(C)(C)C(Oc6ccc(C#N)c(Cl)c6)C4(C)C)C5=O)CC3)CC2)C1 |
| InChI | InChI=1S/C42H52ClN5O4/c1-39(2,3)52-38(50)47-25-42(26-47)18-20-46(21-19-42)30-14-9-27(10-15-30)8-12-29-13-17-32-34(45-29)24-48(35(32)49)36-40(4,5)37(41(36,6)7)51-31-16-11-28(23-44)33(43)22-31/h11,13,16-17,22,27,30,36-37H,9-10,14-15,18-21,24-26H2,1-7H3 |
| InChIKey | TUJOESXHTDMGRY-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 99.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.36 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|