C35H42ClN5O4 — CID 163703764
tert-butyl 3-[3-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-hydroxy-5,7-dihydropyrrolo[3,4-b]pyridin-2-yl]ethynyl]azetidin-1-yl]azetidine-1-carboxylate (PubChem CID 163703764) has the molecular formula C35H42ClN5O4 and a molecular weight of 632.21 g/mol. Its IUPAC name is tert-butyl 3-[3-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-hydroxy-5,7-dihydropyrrolo[3,4-b]pyridin-2-yl]ethynyl]azetidin-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-hydroxy-5,7-dihydropyrrolo[3,4-b]pyridin-2-yl]ethynyl]azetidin-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163703764 |
| Molecular Formula | C35H42ClN5O4 |
| Molecular Weight | 632.21 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | tert-butyl 3-[3-[2-[6-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5-hydroxy-5,7-dihydropyrrolo[3,4-b]pyridin-2-yl]ethynyl]azetidin-1-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N2CC(C#Cc3ccc4c(n3)CN(C3C(C)(C)C(Oc5ccc(C#N)c(Cl)c5)C3(C)C)C4O)C2)C1 |
| InChI | InChI=1S/C35H42ClN5O4/c1-33(2,3)45-32(43)40-18-24(19-40)39-16-21(17-39)8-10-23-11-13-26-28(38-23)20-41(29(26)42)30-34(4,5)31(35(30,6)7)44-25-12-9-22(15-37)27(36)14-25/h9,11-14,21,24,29-31,42H,16-20H2,1-7H3 |
| InChIKey | KDGUKOVUBIZGCL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.21 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|