C24H24ClN3O3 — CID 170513903
1-[4-[(3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylazetidine-1-carbonyl]phenyl]piperidin-4-one (PubChem CID 170513903) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is 1-[4-[(3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylazetidine-1-carbonyl]phenyl]piperidin-4-one.
| Compound Name | 1-[4-[(3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylazetidine-1-carbonyl]phenyl]piperidin-4-one |
|---|---|
| PubChem CID | 170513903 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 1-[4-[(3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylazetidine-1-carbonyl]phenyl]piperidin-4-one |
| SMILES | [C-]#[N+]c1ccc(O[C@H]2CN(C(=O)c3ccc(N4CCC(=O)CC4)cc3)C2(C)C)cc1Cl |
| InChI | InChI=1S/C24H24ClN3O3/c1-24(2)22(31-19-8-9-21(26-3)20(25)14-19)15-28(24)23(30)16-4-6-17(7-5-16)27-12-10-18(29)11-13-27/h4-9,14,22H,10-13,15H2,1-2H3/t22-/m0/s1 |
| InChIKey | XXGHJOOTCSBGAO-QFIPXVFZSA-N |
| XLogP | 4.74 |
| TPSA | 54.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|