C27H32ClN3O2 — CID 166046296
tert-butyl 4-[(3S)-2-(3-chloro-4-isocyanophenyl)-3-methyl-2,8-diazaspiro[4.5]decan-8-yl]benzoate (PubChem CID 166046296) has the molecular formula C27H32ClN3O2 and a molecular weight of 466.03 g/mol. Its IUPAC name is tert-butyl 4-[(3S)-2-(3-chloro-4-isocyanophenyl)-3-methyl-2,8-diazaspiro[4.5]decan-8-yl]benzoate.
| Compound Name | tert-butyl 4-[(3S)-2-(3-chloro-4-isocyanophenyl)-3-methyl-2,8-diazaspiro[4.5]decan-8-yl]benzoate |
|---|---|
| PubChem CID | 166046296 |
| Molecular Formula | C27H32ClN3O2 |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | tert-butyl 4-[(3S)-2-(3-chloro-4-isocyanophenyl)-3-methyl-2,8-diazaspiro[4.5]decan-8-yl]benzoate |
| SMILES | [C-]#[N+]c1ccc(N2CC3(CCN(c4ccc(C(=O)OC(C)(C)C)cc4)CC3)C[C@@H]2C)cc1Cl |
| InChI | InChI=1S/C27H32ClN3O2/c1-19-17-27(18-31(19)22-10-11-24(29-5)23(28)16-22)12-14-30(15-13-27)21-8-6-20(7-9-21)25(32)33-26(2,3)4/h6-11,16,19H,12-15,17-18H2,1-4H3/t19-/m0/s1 |
| InChIKey | RCLSTWDLQJDWSK-IBGZPJMESA-N |
| XLogP | 6.73 |
| TPSA | 37.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|