C31H40ClN5O2 — CID 171719635
tert-butyl 4-[4-[(3S)-2-(3-chloro-4-isocyanophenyl)-3-methyl-2,8-diazaspiro[4.5]decan-8-yl]phenyl]piperazine-1-carboxylate (PubChem CID 171719635) has the molecular formula C31H40ClN5O2 and a molecular weight of 550.15 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3S)-2-(3-chloro-4-isocyanophenyl)-3-methyl-2,8-diazaspiro[4.5]decan-8-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3S)-2-(3-chloro-4-isocyanophenyl)-3-methyl-2,8-diazaspiro[4.5]decan-8-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171719635 |
| Molecular Formula | C31H40ClN5O2 |
| Molecular Weight | 550.15 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | tert-butyl 4-[4-[(3S)-2-(3-chloro-4-isocyanophenyl)-3-methyl-2,8-diazaspiro[4.5]decan-8-yl]phenyl]piperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(N2CC3(CCN(c4ccc(N5CCN(C(=O)OC(C)(C)C)CC5)cc4)CC3)C[C@@H]2C)cc1Cl |
| InChI | InChI=1S/C31H40ClN5O2/c1-23-21-31(22-37(23)26-10-11-28(33-5)27(32)20-26)12-14-34(15-13-31)24-6-8-25(9-7-24)35-16-18-36(19-17-35)29(38)39-30(2,3)4/h6-11,20,23H,12-19,21-22H2,1-4H3/t23-/m0/s1 |
| InChIKey | LFNNWNVNUOYOOF-QHCPKHFHSA-N |
| XLogP | 6.83 |
| TPSA | 43.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.15 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|