C18H24ClN3O2 — CID 156663186
tert-butyl (2R,5S)-4-(3-chloro-4-isocyanophenyl)-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 156663186) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-(3-chloro-4-isocyanophenyl)-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-(3-chloro-4-isocyanophenyl)-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 156663186 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | tert-butyl (2R,5S)-4-(3-chloro-4-isocyanophenyl)-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(N2C[C@@H](C)N(C(=O)OC(C)(C)C)C[C@@H]2C)cc1Cl |
| InChI | InChI=1S/C18H24ClN3O2/c1-12-11-22(17(23)24-18(3,4)5)13(2)10-21(12)14-7-8-16(20-6)15(19)9-14/h7-9,12-13H,10-11H2,1-5H3/t12-,13+/m0/s1 |
| InChIKey | BNMAKCDXBNABEW-QWHCGFSZSA-N |
| XLogP | 4.72 |
| TPSA | 37.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|