C19H22BrCl2FN4O2 — CID 174152320
tert-butyl (2R,5R)-4-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 174152320) has the molecular formula C19H22BrCl2FN4O2 and a molecular weight of 508.22 g/mol. Its IUPAC name is tert-butyl (2R,5R)-4-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-4-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 174152320 |
| Molecular Formula | C19H22BrCl2FN4O2 |
| Molecular Weight | 508.22 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | tert-butyl (2R,5R)-4-(7-bromo-2,6-dichloro-8-fluoroquinazolin-4-yl)-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2nc(Cl)nc3c(F)c(Br)c(Cl)cc23)[C@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H22BrCl2FN4O2/c1-9-8-27(18(28)29-19(3,4)5)10(2)7-26(9)16-11-6-12(21)13(20)14(23)15(11)24-17(22)25-16/h6,9-10H,7-8H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | FTVQBZHTIZZTNB-NXEZZACHSA-N |
| XLogP | 5.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.22 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|