C19H23BrClFN4O4S — CID 171484065
tert-butyl (3S)-4-(7-bromo-6-chloro-8-fluoro-2-methylsulfonylquinazolin-4-yl)-3-methylpiperazine-1-carboxylate (PubChem CID 171484065) has the molecular formula C19H23BrClFN4O4S and a molecular weight of 537.84 g/mol. Its IUPAC name is tert-butyl (3S)-4-(7-bromo-6-chloro-8-fluoro-2-methylsulfonylquinazolin-4-yl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(7-bromo-6-chloro-8-fluoro-2-methylsulfonylquinazolin-4-yl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171484065 |
| Molecular Formula | C19H23BrClFN4O4S |
| Molecular Weight | 537.84 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | tert-butyl (3S)-4-(7-bromo-6-chloro-8-fluoro-2-methylsulfonylquinazolin-4-yl)-3-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1c1nc(S(C)(=O)=O)nc2c(F)c(Br)c(Cl)cc12 |
| InChI | InChI=1S/C19H23BrClFN4O4S/c1-10-9-25(18(27)30-19(2,3)4)6-7-26(10)16-11-8-12(21)13(20)14(22)15(11)23-17(24-16)31(5,28)29/h8,10H,6-7,9H2,1-5H3/t10-/m0/s1 |
| InChIKey | BVLGIRVOJXPSJV-JTQLQIEISA-N |
| XLogP | 4.03 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.84 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|