C17H20BrClFN3O3 — CID 121331481
tert-butyl 4-(7-bromo-5-chloro-4-fluoro-1,3-benzoxazol-2-yl)-3-methylpiperazine-1-carboxylate (PubChem CID 121331481) has the molecular formula C17H20BrClFN3O3 and a molecular weight of 448.72 g/mol. Its IUPAC name is tert-butyl 4-(7-bromo-5-chloro-4-fluoro-1,3-benzoxazol-2-yl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(7-bromo-5-chloro-4-fluoro-1,3-benzoxazol-2-yl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 121331481 |
| Molecular Formula | C17H20BrClFN3O3 |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | tert-butyl 4-(7-bromo-5-chloro-4-fluoro-1,3-benzoxazol-2-yl)-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1c1nc2c(F)c(Cl)cc(Br)c2o1 |
| InChI | InChI=1S/C17H20BrClFN3O3/c1-9-8-22(16(24)26-17(2,3)4)5-6-23(9)15-21-13-12(20)11(19)7-10(18)14(13)25-15/h7,9H,5-6,8H2,1-4H3 |
| InChIKey | WGBOJGICQUPZKJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|