C22H23ClF2N4O3 — CID 121331494
tert-butyl 4-(5-chloro-4,6-difluoro-7-pyridin-2-yl-1,3-benzoxazol-2-yl)-3-methylpiperazine-1-carboxylate (PubChem CID 121331494) has the molecular formula C22H23ClF2N4O3 and a molecular weight of 464.90 g/mol. Its IUPAC name is tert-butyl 4-(5-chloro-4,6-difluoro-7-pyridin-2-yl-1,3-benzoxazol-2-yl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-chloro-4,6-difluoro-7-pyridin-2-yl-1,3-benzoxazol-2-yl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 121331494 |
| Molecular Formula | C22H23ClF2N4O3 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | tert-butyl 4-(5-chloro-4,6-difluoro-7-pyridin-2-yl-1,3-benzoxazol-2-yl)-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1c1nc2c(F)c(Cl)c(F)c(-c3ccccn3)c2o1 |
| InChI | InChI=1S/C22H23ClF2N4O3/c1-12-11-28(21(30)32-22(2,3)4)9-10-29(12)20-27-18-17(25)15(23)16(24)14(19(18)31-20)13-7-5-6-8-26-13/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | BDRJMGVVRLROIG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|