C19H21BrClFN4O5 — CID 138721296
tert-butyl (3R)-4-(7-bromo-6-chloro-8-fluoro-3-nitroquinolin-4-yl)-3-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 138721296) has the molecular formula C19H21BrClFN4O5 and a molecular weight of 519.76 g/mol. Its IUPAC name is tert-butyl (3R)-4-(7-bromo-6-chloro-8-fluoro-3-nitroquinolin-4-yl)-3-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(7-bromo-6-chloro-8-fluoro-3-nitroquinolin-4-yl)-3-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 138721296 |
| Molecular Formula | C19H21BrClFN4O5 |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | tert-butyl (3R)-4-(7-bromo-6-chloro-8-fluoro-3-nitroquinolin-4-yl)-3-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c([N+](=O)[O-])cnc3c(F)c(Br)c(Cl)cc23)[C@@H](CO)C1 |
| InChI | InChI=1S/C19H21BrClFN4O5/c1-19(2,3)31-18(28)24-4-5-25(10(8-24)9-27)17-11-6-12(21)14(20)15(22)16(11)23-7-13(17)26(29)30/h6-7,10,27H,4-5,8-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | QDEDMZUBKZUHMR-SNVBAGLBSA-N |
| XLogP | 4.12 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|