C19H22BrClN4O4 — CID 139294541
tert-butyl 4-(7-bromo-6-chloro-3-nitroquinolin-4-yl)-2-methylpiperazine-1-carboxylate (PubChem CID 139294541) has the molecular formula C19H22BrClN4O4 and a molecular weight of 485.77 g/mol. Its IUPAC name is tert-butyl 4-(7-bromo-6-chloro-3-nitroquinolin-4-yl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(7-bromo-6-chloro-3-nitroquinolin-4-yl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 139294541 |
| Molecular Formula | C19H22BrClN4O4 |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | tert-butyl 4-(7-bromo-6-chloro-3-nitroquinolin-4-yl)-2-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(c2c([N+](=O)[O-])cnc3cc(Br)c(Cl)cc23)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H22BrClN4O4/c1-11-10-23(5-6-24(11)18(26)29-19(2,3)4)17-12-7-14(21)13(20)8-15(12)22-9-16(17)25(27)28/h7-9,11H,5-6,10H2,1-4H3 |
| InChIKey | DMFQWHGOIJPCBK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|