C21H24BrClN4O3 — CID 138721102
tert-butyl (7R)-15-bromo-16-chloro-9-ethyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate (PubChem CID 138721102) has the molecular formula C21H24BrClN4O3 and a molecular weight of 495.81 g/mol. Its IUPAC name is tert-butyl (7R)-15-bromo-16-chloro-9-ethyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate.
| Compound Name | tert-butyl (7R)-15-bromo-16-chloro-9-ethyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 138721102 |
| Molecular Formula | C21H24BrClN4O3 |
| Molecular Weight | 495.81 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | tert-butyl (7R)-15-bromo-16-chloro-9-ethyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
| SMILES | CCN1C(=O)[C@H]2CN(C(=O)OC(C)(C)C)CCN2c2c1cnc1cc(Br)c(Cl)cc21 |
| InChI | InChI=1S/C21H24BrClN4O3/c1-5-26-16-10-24-15-9-13(22)14(23)8-12(15)18(16)27-7-6-25(11-17(27)19(26)28)20(29)30-21(2,3)4/h8-10,17H,5-7,11H2,1-4H3/t17-/m1/s1 |
| InChIKey | VKZCLQMQOPVHDF-QGZVFWFLSA-N |
| XLogP | 4.44 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |