C20H21BrClFN4O3 — CID 138720971
tert-butyl (7R)-15-bromo-14-chloro-16-fluoro-9-methyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate (PubChem CID 138720971) has the molecular formula C20H21BrClFN4O3 and a molecular weight of 499.77 g/mol. Its IUPAC name is tert-butyl (7R)-15-bromo-14-chloro-16-fluoro-9-methyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate.
| Compound Name | tert-butyl (7R)-15-bromo-14-chloro-16-fluoro-9-methyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 138720971 |
| Molecular Formula | C20H21BrClFN4O3 |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | tert-butyl (7R)-15-bromo-14-chloro-16-fluoro-9-methyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
| SMILES | CN1C(=O)[C@H]2CN(C(=O)OC(C)(C)C)CCN2c2c1cnc1c(Cl)c(Br)c(F)cc21 |
| InChI | InChI=1S/C20H21BrClFN4O3/c1-20(2,3)30-19(29)26-5-6-27-13(9-26)18(28)25(4)12-8-24-16-10(17(12)27)7-11(23)14(21)15(16)22/h7-8,13H,5-6,9H2,1-4H3/t13-/m1/s1 |
| InChIKey | WFLFPBVHLLXLFI-CYBMUJFWSA-N |
| XLogP | 4.19 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|