C11H17N3O5 — CID 118525644
tert-butyl (8aS)-2-hydroxy-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate (PubChem CID 118525644) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is tert-butyl (8aS)-2-hydroxy-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl (8aS)-2-hydroxy-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 118525644 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | tert-butyl (8aS)-2-hydroxy-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=O)N(O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C11H17N3O5/c1-11(2,3)19-10(17)12-4-5-13-7(6-12)8(15)14(18)9(13)16/h7,18H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | NBMQYXZWTRXBOA-ZETCQYMHSA-N |
| XLogP | 0.26 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|