C13H21BrN2O3 — CID 58430292
tert-butyl (3R)-3-(3-bromo-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate (PubChem CID 58430292) has the molecular formula C13H21BrN2O3 and a molecular weight of 333.23 g/mol. Its IUPAC name is tert-butyl (3R)-3-(3-bromo-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(3-bromo-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58430292 |
| Molecular Formula | C13H21BrN2O3 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | tert-butyl (3R)-3-(3-bromo-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](N2CCC(Br)C2=O)C1 |
| InChI | InChI=1S/C13H21BrN2O3/c1-13(2,3)19-12(18)15-6-4-9(8-15)16-7-5-10(14)11(16)17/h9-10H,4-8H2,1-3H3/t9-,10?/m1/s1 |
| InChIKey | IAFQCTNFEPWZES-YHMJZVADSA-N |
| XLogP | 1.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|