C13H21ClN2O3 — CID 168686809
tert-butyl (3R)-3-(4-chloro-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate (PubChem CID 168686809) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. Its IUPAC name is tert-butyl (3R)-3-(4-chloro-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(4-chloro-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168686809 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | tert-butyl (3R)-3-(4-chloro-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](N2CC(Cl)CC2=O)C1 |
| InChI | InChI=1S/C13H21ClN2O3/c1-13(2,3)19-12(18)15-5-4-10(8-15)16-7-9(14)6-11(16)17/h9-10H,4-8H2,1-3H3/t9?,10-/m1/s1 |
| InChIKey | VTVLHTVBPGOELN-QVDQXJPCSA-N |
| XLogP | 1.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|