C14H25N3O5S — CID 168680158
tert-butyl 3-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrrolidine-1-carboxylate (PubChem CID 168680158) has the molecular formula C14H25N3O5S and a molecular weight of 347.44 g/mol. Its IUPAC name is tert-butyl 3-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168680158 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | tert-butyl 3-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CC(CS(N)(=O)=O)CC2=O)C1 |
| InChI | InChI=1S/C14H25N3O5S/c1-14(2,3)22-13(19)16-5-4-11(8-16)17-7-10(6-12(17)18)9-23(15,20)21/h10-11H,4-9H2,1-3H3,(H2,15,20,21) |
| InChIKey | NWMGQUCRLOIQTF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |