C13H21FN2O5S — CID 168675053
tert-butyl 3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]azetidine-1-carboxylate (PubChem CID 168675053) has the molecular formula C13H21FN2O5S and a molecular weight of 336.39 g/mol. Its IUPAC name is tert-butyl 3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 168675053 |
| Molecular Formula | C13H21FN2O5S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | tert-butyl 3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N2CC(CS(=O)(=O)F)CC2=O)C1 |
| InChI | InChI=1S/C13H21FN2O5S/c1-13(2,3)21-12(18)15-6-10(7-15)16-5-9(4-11(16)17)8-22(14,19)20/h9-10H,4-8H2,1-3H3 |
| InChIKey | NGUBNOHWPLBRAB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |