C9H14FNO5S — CID 168675038
2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-2-methylpropanoic acid (PubChem CID 168675038) has the molecular formula C9H14FNO5S and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 168675038 |
| Molecular Formula | C9H14FNO5S |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C9H14FNO5S/c1-9(2,8(13)14)11-4-6(3-7(11)12)5-17(10,15)16/h6H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | QTSJWKCCUBOZGI-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |